About N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide (PubChem CID 87043664) has the molecular formula C18H19FN4O2
and a molecular weight of 342.37 g/mol. Its IUPAC name is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide.
Molecular Properties
| Compound Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide |
| PubChem CID | 87043664 |
| Molecular Formula | C18H19FN4O2 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide |
| SMILES | CCc1c(C(=O)NCc2nc(C)c(C)o2)cnn1-c1ccc(F)cc1 |
| InChI | InChI=1S/C18H19FN4O2/c1-4-16-15(9-21-23(16)14-7-5-13(19)6-8-14)18(24)20-10-17-22-11(2)12(3)25-17/h5-9H,4,10H2,1-3H3,(H,20,24) |
| InChIKey | VVWNJVSFMZHCFC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 72.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide?
The IUPAC name of N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide (CID 87043664) is N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide.
What is the SMILES notation for N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide?
The canonical SMILES for N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide is CCc1c(C(=O)NCc2nc(C)c(C)o2)cnn1-c1ccc(F)cc1.
What is the InChIKey of N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide?
The InChIKey is VVWNJVSFMZHCFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19FN4O2/c1-4-16-15(9-21-23(16)14-7-5-13(19)6-8-14)18(24)20-10-17-22-11(2)12(3)25-17/h5-9H,4,10H2,1-3H3,(H,20,24).
What are the key properties of N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide?
N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide has a molecular weight of 342.37 g/mol, XLogP of 3.11, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4,5-dimethyl-1,3-oxazol-2-yl)methyl]-5-ethyl-1-(4-fluorophenyl)pyrazole-4-carboxamide is sourced from PubChem (CID 87043664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).