C14H15N5O4 — CID 87044112
N-(4-ethyl-3-nitrophenyl)-N'-(1-methylpyrazol-4-yl)oxamide (PubChem CID 87044112) has the molecular formula C14H15N5O4 and a molecular weight of 317.31 g/mol. Its IUPAC name is N-(4-ethyl-3-nitrophenyl)-N'-(1-methylpyrazol-4-yl)oxamide.
| Compound Name | N-(4-ethyl-3-nitrophenyl)-N'-(1-methylpyrazol-4-yl)oxamide |
|---|---|
| PubChem CID | 87044112 |
| Molecular Formula | C14H15N5O4 |
| Molecular Weight | 317.31 g/mol |
| Exact Mass | 317.11 |
| IUPAC Name | N-(4-ethyl-3-nitrophenyl)-N'-(1-methylpyrazol-4-yl)oxamide |
| SMILES | CCc1ccc(NC(=O)C(=O)Nc2cnn(C)c2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H15N5O4/c1-3-9-4-5-10(6-12(9)19(22)23)16-13(20)14(21)17-11-7-15-18(2)8-11/h4-8H,3H2,1-2H3,(H,16,20)(H,17,21) |
| InChIKey | FFBNIHCBUFJYIH-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 119.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.31 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|