C18H22N4O3 — CID 87044649
ethyl N-[2-methyl-3-[(6-methyl-2-pyridinyl)methylcarbamoylamino]phenyl]carbamate (PubChem CID 87044649) has the molecular formula C18H22N4O3 and a molecular weight of 342.40 g/mol. Its IUPAC name is ethyl N-[2-methyl-3-[(6-methyl-2-pyridinyl)methylcarbamoylamino]phenyl]carbamate.
| Compound Name | ethyl N-[2-methyl-3-[(6-methyl-2-pyridinyl)methylcarbamoylamino]phenyl]carbamate |
|---|---|
| PubChem CID | 87044649 |
| Molecular Formula | C18H22N4O3 |
| Molecular Weight | 342.40 g/mol |
| Exact Mass | 342.17 |
| IUPAC Name | ethyl N-[2-methyl-3-[(6-methyl-2-pyridinyl)methylcarbamoylamino]phenyl]carbamate |
| SMILES | CCOC(=O)Nc1cccc(NC(=O)NCc2cccc(C)n2)c1C |
| InChI | InChI=1S/C18H22N4O3/c1-4-25-18(24)22-16-10-6-9-15(13(16)3)21-17(23)19-11-14-8-5-7-12(2)20-14/h5-10H,4,11H2,1-3H3,(H,22,24)(H2,19,21,23) |
| InChIKey | IKQPQYKBKMGSSS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 92.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.40 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |