C24H27N5O3 — CID 87045977
4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide (PubChem CID 87045977) has the molecular formula C24H27N5O3 and a molecular weight of 433.51 g/mol. Its IUPAC name is 4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide.
| Compound Name | 4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide |
|---|---|
| PubChem CID | 87045977 |
| Molecular Formula | C24H27N5O3 |
| Molecular Weight | 433.51 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 4-[[[2-(4-methoxyphenyl)acetyl]amino]methyl]-N-(5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)benzamide |
| SMILES | COc1ccc(CC(=O)NCc2ccc(C(=O)NCc3nnc4n3CCCC4)cc2)cc1 |
| InChI | InChI=1S/C24H27N5O3/c1-32-20-11-7-17(8-12-20)14-23(30)25-15-18-5-9-19(10-6-18)24(31)26-16-22-28-27-21-4-2-3-13-29(21)22/h5-12H,2-4,13-16H2,1H3,(H,25,30)(H,26,31) |
| InChIKey | SNSSSRYICFDSCL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.51 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |