C20H22N2O3 — CID 87046966
methyl 6-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]pyridine-3-carboxylate (PubChem CID 87046966) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is methyl 6-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]pyridine-3-carboxylate.
| Compound Name | methyl 6-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 87046966 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | methyl 6-[2-(2-phenylethyl)pyrrolidine-1-carbonyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1ccc(C(=O)N2CCCC2CCc2ccccc2)nc1 |
| InChI | InChI=1S/C20H22N2O3/c1-25-20(24)16-10-12-18(21-14-16)19(23)22-13-5-8-17(22)11-9-15-6-3-2-4-7-15/h2-4,6-7,10,12,14,17H,5,8-9,11,13H2,1H3 |
| InChIKey | TXWKEJSTFGVTEA-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |