C23H36N2O8 — CID 87047383
[(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(morpholin-4-ylamino)-4-oxobutanoate (PubChem CID 87047383) has the molecular formula C23H36N2O8 and a molecular weight of 468.55 g/mol. Its IUPAC name is [(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(morpholin-4-ylamino)-4-oxobutanoate.
| Compound Name | [(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(morpholin-4-ylamino)-4-oxobutanoate |
|---|---|
| PubChem CID | 87047383 |
| Molecular Formula | C23H36N2O8 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.25 |
| IUPAC Name | [(1S,5R,9R,10S,12R,13R)-1,5,9-trimethyl-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecan-10-yl] 4-(morpholin-4-ylamino)-4-oxobutanoate |
| SMILES | C[C@@H]1CCC2[C@@H](C)[C@H](OC(=O)CCC(=O)NN3CCOCC3)O[C@@H]3O[C@]4(C)CCC1[C@@]23OO4 |
| InChI | InChI=1S/C23H36N2O8/c1-14-4-5-17-15(2)20(29-19(27)7-6-18(26)24-25-10-12-28-13-11-25)30-21-23(17)16(14)8-9-22(3,31-21)32-33-23/h14-17,20-21H,4-13H2,1-3H3,(H,24,26)/t14-,15-,16?,17?,20-,21-,22+,23-/m1/s1 |
| InChIKey | FBQSKFBDDWKIAP-WUDLHKILSA-N |
| XLogP | 1.88 |
| TPSA | 104.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|