C29H25ClN4OS — CID 87048019
2-[4-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(9-ethylcarbazol-3-yl)propanamide (PubChem CID 87048019) has the molecular formula C29H25ClN4OS and a molecular weight of 513.07 g/mol. Its IUPAC name is 2-[4-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(9-ethylcarbazol-3-yl)propanamide.
| Compound Name | 2-[4-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(9-ethylcarbazol-3-yl)propanamide |
|---|---|
| PubChem CID | 87048019 |
| Molecular Formula | C29H25ClN4OS |
| Molecular Weight | 513.07 g/mol |
| Exact Mass | 512.14 |
| IUPAC Name | 2-[4-[(2-chloro-3-pyridinyl)methylideneamino]phenyl]sulfanyl-N-(9-ethylcarbazol-3-yl)propanamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)C(C)Sc3ccc(/N=C/c4cccnc4Cl)cc3)ccc21 |
| InChI | InChI=1S/C29H25ClN4OS/c1-3-34-26-9-5-4-8-24(26)25-17-22(12-15-27(25)34)33-29(35)19(2)36-23-13-10-21(11-14-23)32-18-20-7-6-16-31-28(20)30/h4-19H,3H2,1-2H3,(H,33,35)/b32-18+ |
| InChIKey | HTTKNFFWTJHNBE-KCSSXMTESA-N |
| XLogP | 7.73 |
| TPSA | 59.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.07 |
| LogP ≤ 5 | 7.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|