C33H44ClN3O4 — CID 87048866
(5R,7S)-6-N-(3-chloro-4-methylphenyl)-2-N,3-bis(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87048866) has the molecular formula C33H44ClN3O4 and a molecular weight of 582.19 g/mol. Its IUPAC name is (5R,7S)-6-N-(3-chloro-4-methylphenyl)-2-N,3-bis(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5R,7S)-6-N-(3-chloro-4-methylphenyl)-2-N,3-bis(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87048866 |
| Molecular Formula | C33H44ClN3O4 |
| Molecular Weight | 582.19 g/mol |
| Exact Mass | 581.30 |
| IUPAC Name | (5R,7S)-6-N-(3-chloro-4-methylphenyl)-2-N,3-bis(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1ccc(NC(=O)C2[C@@H]3C=CC4(O3)C(C(=O)NC3CCCC(C)C3C)N(C3CCCC(C)C3C)C(=O)[C@H]24)cc1Cl |
| InChI | InChI=1S/C33H44ClN3O4/c1-17-8-6-10-24(20(17)4)36-31(39)29-33-15-14-26(41-33)27(30(38)35-22-13-12-19(3)23(34)16-22)28(33)32(40)37(29)25-11-7-9-18(2)21(25)5/h12-18,20-21,24-29H,6-11H2,1-5H3,(H,35,38)(H,36,39)/t17?,18?,20?,21?,24?,25?,26-,27?,28-,29?,33?/m0/s1 |
| InChIKey | JOLURQAGCDHISX-FFYSUIHJSA-N |
| XLogP | 5.50 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.19 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|