C31H32Cl2FN3O4 — CID 87049029
(5S,7R)-6-N-(3-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049029) has the molecular formula C31H32Cl2FN3O4 and a molecular weight of 600.52 g/mol. Its IUPAC name is (5S,7R)-6-N-(3-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-6-N-(3-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049029 |
| Molecular Formula | C31H32Cl2FN3O4 |
| Molecular Weight | 600.52 g/mol |
| Exact Mass | 599.18 |
| IUPAC Name | (5S,7R)-6-N-(3-chloro-4-fluorophenyl)-3-[(4-chlorophenyl)methyl]-2-N-(2,3-dimethylcyclohexyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | CC1CCCC(NC(=O)C2N(Cc3ccc(Cl)cc3)C(=O)[C@H]3C(C(=O)Nc4ccc(F)c(Cl)c4)[C@H]4C=CC23O4)C1C |
| InChI | InChI=1S/C31H32Cl2FN3O4/c1-16-4-3-5-23(17(16)2)36-29(39)27-31-13-12-24(41-31)25(28(38)35-20-10-11-22(34)21(33)14-20)26(31)30(40)37(27)15-18-6-8-19(32)9-7-18/h6-14,16-17,23-27H,3-5,15H2,1-2H3,(H,35,38)(H,36,39)/t16?,17?,23?,24-,25?,26-,27?,31?/m1/s1 |
| InChIKey | LEQYDUGETLWHAH-MHJKDPAVSA-N |
| XLogP | 5.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.52 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|