C29H37N3O6 — CID 87049702
(5S,7R)-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049702) has the molecular formula C29H37N3O6 and a molecular weight of 523.63 g/mol. Its IUPAC name is (5S,7R)-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049702 |
| Molecular Formula | C29H37N3O6 |
| Molecular Weight | 523.63 g/mol |
| Exact Mass | 523.27 |
| IUPAC Name | (5S,7R)-6-N-(3-methoxyphenyl)-2-N-(2-methylcyclohexyl)-4-oxo-3-(oxolan-2-ylmethyl)-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | COc1cccc(NC(=O)C2[C@H]3C=CC4(O3)C(C(=O)NC3CCCCC3C)N(CC3CCCO3)C(=O)[C@@H]24)c1 |
| InChI | InChI=1S/C29H37N3O6/c1-17-7-3-4-11-21(17)31-27(34)25-29-13-12-22(38-29)23(26(33)30-18-8-5-9-19(15-18)36-2)24(29)28(35)32(25)16-20-10-6-14-37-20/h5,8-9,12-13,15,17,20-25H,3-4,6-7,10-11,14,16H2,1-2H3,(H,30,33)(H,31,34)/t17?,20?,21?,22-,23?,24-,25?,29?/m1/s1 |
| InChIKey | RIPHZONYKZCRAI-NSEJEKBXSA-N |
| XLogP | 2.66 |
| TPSA | 106.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.63 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|