C31H41N3O4 — CID 87049808
(5S,7R)-2-N,3-bis(2-methylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide (PubChem CID 87049808) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is (5S,7R)-2-N,3-bis(2-methylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide.
| Compound Name | (5S,7R)-2-N,3-bis(2-methylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
|---|---|
| PubChem CID | 87049808 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | (5S,7R)-2-N,3-bis(2-methylcyclohexyl)-6-N-(3-methylphenyl)-4-oxo-10-oxa-3-azatricyclo[5.2.1.01,5]dec-8-ene-2,6-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)C2[C@H]3C=CC4(O3)C(C(=O)NC3CCCCC3C)N(C3CCCCC3C)C(=O)[C@@H]24)c1 |
| InChI | InChI=1S/C31H41N3O4/c1-18-9-8-12-21(17-18)32-28(35)25-24-15-16-31(38-24)26(25)30(37)34(23-14-7-5-11-20(23)3)27(31)29(36)33-22-13-6-4-10-19(22)2/h8-9,12,15-17,19-20,22-27H,4-7,10-11,13-14H2,1-3H3,(H,32,35)(H,33,36)/t19?,20?,22?,23?,24-,25?,26-,27?,31?/m1/s1 |
| InChIKey | WDOKYYNBERNPLV-HZHMGKRBSA-N |
| XLogP | 4.36 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|