C18H21N3O4 — CID 87050347
2-(3-acetamido-6-methyl-2-oxo-1-pyridinyl)-N-[(4-methoxyphenyl)methyl]acetamide (PubChem CID 87050347) has the molecular formula C18H21N3O4 and a molecular weight of 343.38 g/mol. Its IUPAC name is 2-(3-acetamido-6-methyl-2-oxo-1-pyridinyl)-N-[(4-methoxyphenyl)methyl]acetamide.
| Compound Name | 2-(3-acetamido-6-methyl-2-oxo-1-pyridinyl)-N-[(4-methoxyphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 87050347 |
| Molecular Formula | C18H21N3O4 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.15 |
| IUPAC Name | 2-(3-acetamido-6-methyl-2-oxo-1-pyridinyl)-N-[(4-methoxyphenyl)methyl]acetamide |
| SMILES | COc1ccc(CNC(=O)Cn2c(C)ccc(NC(C)=O)c2=O)cc1 |
| InChI | InChI=1S/C18H21N3O4/c1-12-4-9-16(20-13(2)22)18(24)21(12)11-17(23)19-10-14-5-7-15(25-3)8-6-14/h4-9H,10-11H2,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | FSOHCXRTURFXHK-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 89.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |