C18H21NO5 — CID 8705093
[(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate (PubChem CID 8705093) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
|---|---|
| PubChem CID | 8705093 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | [(2S)-1-(cyclopentylamino)-1-oxopropan-2-yl] (E)-3-(1,3-benzodioxol-5-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccc2c(c1)OCO2)C(=O)NC1CCCC1 |
| InChI | InChI=1S/C18H21NO5/c1-12(18(21)19-14-4-2-3-5-14)24-17(20)9-7-13-6-8-15-16(10-13)23-11-22-15/h6-10,12,14H,2-5,11H2,1H3,(H,19,21)/b9-7+/t12-/m0/s1 |
| InChIKey | IALCMJRETJRWJK-CRALRDPISA-N |
| XLogP | 2.42 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|