C18H22N4O2S — CID 8705185
4-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione (PubChem CID 8705185) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is 4-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione.
| Compound Name | 4-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
|---|---|
| PubChem CID | 8705185 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 4-[[5-[4-[(1S)-1-hydroxyethyl]phenyl]furan-2-yl]methylamino]-3-propyl-1H-1,2,4-triazole-5-thione |
| SMILES | CCCc1n[nH]c(=S)n1NCc1ccc(-c2ccc([C@H](C)O)cc2)o1 |
| InChI | InChI=1S/C18H22N4O2S/c1-3-4-17-20-21-18(25)22(17)19-11-15-9-10-16(24-15)14-7-5-13(6-8-14)12(2)23/h5-10,12,19,23H,3-4,11H2,1-2H3,(H,21,25)/t12-/m0/s1 |
| InChIKey | SZOBUESYDLZYJL-LBPRGKRZSA-N |
| XLogP | 3.95 |
| TPSA | 79.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|