C15H19FN4O2S — CID 87052122
2-(4-ethyl-1,2,4-triazol-3-yl)-1-(2-fluorophenyl)sulfonylpiperidine (PubChem CID 87052122) has the molecular formula C15H19FN4O2S and a molecular weight of 338.41 g/mol. Its IUPAC name is 2-(4-ethyl-1,2,4-triazol-3-yl)-1-(2-fluorophenyl)sulfonylpiperidine.
| Compound Name | 2-(4-ethyl-1,2,4-triazol-3-yl)-1-(2-fluorophenyl)sulfonylpiperidine |
|---|---|
| PubChem CID | 87052122 |
| Molecular Formula | C15H19FN4O2S |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | 2-(4-ethyl-1,2,4-triazol-3-yl)-1-(2-fluorophenyl)sulfonylpiperidine |
| SMILES | CCn1cnnc1C1CCCCN1S(=O)(=O)c1ccccc1F |
| InChI | InChI=1S/C15H19FN4O2S/c1-2-19-11-17-18-15(19)13-8-5-6-10-20(13)23(21,22)14-9-4-3-7-12(14)16/h3-4,7,9,11,13H,2,5-6,8,10H2,1H3 |
| InChIKey | SSHDCSVVYFBIPD-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 68.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |