C22H21N5O4S2 — CID 87052584
N-methyl-N-[2-oxo-2-(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)ethyl]thiophene-2-sulfonamide (PubChem CID 87052584) has the molecular formula C22H21N5O4S2 and a molecular weight of 483.58 g/mol. Its IUPAC name is N-methyl-N-[2-oxo-2-(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)ethyl]thiophene-2-sulfonamide.
| Compound Name | N-methyl-N-[2-oxo-2-(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)ethyl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 87052584 |
| Molecular Formula | C22H21N5O4S2 |
| Molecular Weight | 483.58 g/mol |
| Exact Mass | 483.10 |
| IUPAC Name | N-methyl-N-[2-oxo-2-(8-oxo-5-phenyl-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-11-yl)ethyl]thiophene-2-sulfonamide |
| SMILES | CN(CC(=O)N1CCc2nc3cc(-c4ccccc4)[nH]n3c(=O)c2C1)S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H21N5O4S2/c1-25(33(30,31)21-8-5-11-32-21)14-20(28)26-10-9-17-16(13-26)22(29)27-19(23-17)12-18(24-27)15-6-3-2-4-7-15/h2-8,11-12,24H,9-10,13-14H2,1H3 |
| InChIKey | PJPLEUUIHSIJEJ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 107.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.58 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |