C22H22N6O3 — CID 87052639
11-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one (PubChem CID 87052639) has the molecular formula C22H22N6O3 and a molecular weight of 418.46 g/mol. Its IUPAC name is 11-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one.
| Compound Name | 11-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
|---|---|
| PubChem CID | 87052639 |
| Molecular Formula | C22H22N6O3 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.18 |
| IUPAC Name | 11-[4-[3-(4-methylphenyl)-1,2,4-oxadiazol-5-yl]butanoyl]-2,6,7,11-tetrazatricyclo[7.4.0.03,7]trideca-1(9),2,4-trien-8-one |
| SMILES | Cc1ccc(-c2noc(CCCC(=O)N3CCc4nc5cc[nH]n5c(=O)c4C3)n2)cc1 |
| InChI | InChI=1S/C22H22N6O3/c1-14-5-7-15(8-6-14)21-25-19(31-26-21)3-2-4-20(29)27-12-10-17-16(13-27)22(30)28-18(24-17)9-11-23-28/h5-9,11,23H,2-4,10,12-13H2,1H3 |
| InChIKey | VXBZYJVRIWVTCB-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 109.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |