C17H23FN2O3S — CID 87053498
N-[[(4aS,7aR)-1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide (PubChem CID 87053498) has the molecular formula C17H23FN2O3S and a molecular weight of 354.45 g/mol. Its IUPAC name is N-[[(4aS,7aR)-1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide.
| Compound Name | N-[[(4aS,7aR)-1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 87053498 |
| Molecular Formula | C17H23FN2O3S |
| Molecular Weight | 354.45 g/mol |
| Exact Mass | 354.14 |
| IUPAC Name | N-[[(4aS,7aR)-1-methyl-2-oxo-3,4,5,6,7,7a-hexahydrocyclopenta[b]pyridin-4a-yl]methyl]-4-fluoro-N-methylbenzenesulfonamide |
| SMILES | CN1C(=O)CC[C@]2(CN(C)S(=O)(=O)c3ccc(F)cc3)CCC[C@@H]12 |
| InChI | InChI=1S/C17H23FN2O3S/c1-19(24(22,23)14-7-5-13(18)6-8-14)12-17-10-3-4-15(17)20(2)16(21)9-11-17/h5-8,15H,3-4,9-12H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | HBBFRWUJWKYZJK-WBVHZDCISA-N |
| XLogP | 2.24 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.45 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |