C25H29N3O3 — CID 87053911
7-(4-tert-butylbenzoyl)-3-[(4-methylphenyl)methyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione (PubChem CID 87053911) has the molecular formula C25H29N3O3 and a molecular weight of 419.53 g/mol. Its IUPAC name is 7-(4-tert-butylbenzoyl)-3-[(4-methylphenyl)methyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione.
| Compound Name | 7-(4-tert-butylbenzoyl)-3-[(4-methylphenyl)methyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
|---|---|
| PubChem CID | 87053911 |
| Molecular Formula | C25H29N3O3 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.22 |
| IUPAC Name | 7-(4-tert-butylbenzoyl)-3-[(4-methylphenyl)methyl]-1,3,7-triazaspiro[4.4]nonane-2,4-dione |
| SMILES | Cc1ccc(CN2C(=O)NC3(CCN(C(=O)c4ccc(C(C)(C)C)cc4)C3)C2=O)cc1 |
| InChI | InChI=1S/C25H29N3O3/c1-17-5-7-18(8-6-17)15-28-22(30)25(26-23(28)31)13-14-27(16-25)21(29)19-9-11-20(12-10-19)24(2,3)4/h5-12H,13-16H2,1-4H3,(H,26,31) |
| InChIKey | YKGRUIHSTGXIOZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|