C12H14BrNO3S — CID 8705420
[2-(methylamino)-2-oxoethyl] 2-(4-bromo-2-methylphenyl)sulfanylacetate (PubChem CID 8705420) has the molecular formula C12H14BrNO3S and a molecular weight of 332.22 g/mol. Its IUPAC name is [2-(methylamino)-2-oxoethyl] 2-(4-bromo-2-methylphenyl)sulfanylacetate.
| Compound Name | [2-(methylamino)-2-oxoethyl] 2-(4-bromo-2-methylphenyl)sulfanylacetate |
|---|---|
| PubChem CID | 8705420 |
| Molecular Formula | C12H14BrNO3S |
| Molecular Weight | 332.22 g/mol |
| Exact Mass | 330.99 |
| IUPAC Name | [2-(methylamino)-2-oxoethyl] 2-(4-bromo-2-methylphenyl)sulfanylacetate |
| SMILES | CNC(=O)COC(=O)CSc1ccc(Br)cc1C |
| InChI | InChI=1S/C12H14BrNO3S/c1-8-5-9(13)3-4-10(8)18-7-12(16)17-6-11(15)14-2/h3-5H,6-7H2,1-2H3,(H,14,15) |
| InChIKey | HDPFZQBBXCGOSY-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.22 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |