C18H26N2O2 — CID 87054496
N-benzyl-N,2-dimethyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide (PubChem CID 87054496) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is N-benzyl-N,2-dimethyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide.
| Compound Name | N-benzyl-N,2-dimethyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
|---|---|
| PubChem CID | 87054496 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | N-benzyl-N,2-dimethyl-8-oxa-2-azaspiro[4.5]decane-4-carboxamide |
| SMILES | CN1CC(C(=O)N(C)Cc2ccccc2)C2(CCOCC2)C1 |
| InChI | InChI=1S/C18H26N2O2/c1-19-13-16(18(14-19)8-10-22-11-9-18)17(21)20(2)12-15-6-4-3-5-7-15/h3-7,16H,8-14H2,1-2H3 |
| InChIKey | FNGVZDVJSJRNSA-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |