C22H20N4O — CID 87054681
4-benzyl-2-(3,5-dimethylanilino)pyrido[3,4-b]pyrazin-3-one (PubChem CID 87054681) has the molecular formula C22H20N4O and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-benzyl-2-(3,5-dimethylanilino)pyrido[3,4-b]pyrazin-3-one.
| Compound Name | 4-benzyl-2-(3,5-dimethylanilino)pyrido[3,4-b]pyrazin-3-one |
|---|---|
| PubChem CID | 87054681 |
| Molecular Formula | C22H20N4O |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 4-benzyl-2-(3,5-dimethylanilino)pyrido[3,4-b]pyrazin-3-one |
| SMILES | Cc1cc(C)cc(Nc2nc3ccncc3n(Cc3ccccc3)c2=O)c1 |
| InChI | InChI=1S/C22H20N4O/c1-15-10-16(2)12-18(11-15)24-21-22(27)26(14-17-6-4-3-5-7-17)20-13-23-9-8-19(20)25-21/h3-13H,14H2,1-2H3,(H,24,25) |
| InChIKey | AKCKQZAQYBCGAB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |