C23H25F3N2O5 — CID 87054936
(7a-pyridin-2-yl-2,3,3a,4,6,7-hexahydrofuro[3,2-c]pyridin-5-yl)-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone (PubChem CID 87054936) has the molecular formula C23H25F3N2O5 and a molecular weight of 466.46 g/mol. Its IUPAC name is (7a-pyridin-2-yl-2,3,3a,4,6,7-hexahydrofuro[3,2-c]pyridin-5-yl)-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone.
| Compound Name | (7a-pyridin-2-yl-2,3,3a,4,6,7-hexahydrofuro[3,2-c]pyridin-5-yl)-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
|---|---|
| PubChem CID | 87054936 |
| Molecular Formula | C23H25F3N2O5 |
| Molecular Weight | 466.46 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | (7a-pyridin-2-yl-2,3,3a,4,6,7-hexahydrofuro[3,2-c]pyridin-5-yl)-[3-methoxy-4-[2-(trifluoromethoxy)ethoxy]phenyl]methanone |
| SMILES | COc1cc(C(=O)N2CCC3(c4ccccn4)OCCC3C2)ccc1OCCOC(F)(F)F |
| InChI | InChI=1S/C23H25F3N2O5/c1-30-19-14-16(5-6-18(19)31-12-13-33-23(24,25)26)21(29)28-10-8-22(17(15-28)7-11-32-22)20-4-2-3-9-27-20/h2-6,9,14,17H,7-8,10-13,15H2,1H3 |
| InChIKey | NUYRCVGEYINIII-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.46 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|