C27H30FN3O9S2 — CID 87055387
2-[4-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)-1,1,3-trioxothieno[2,3-e][1,2,4]thiadiazin-2-yl]-2-methylpropanoic acid (PubChem CID 87055387) has the molecular formula C27H30FN3O9S2 and a molecular weight of 623.68 g/mol. Its IUPAC name is 2-[4-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)-1,1,3-trioxothieno[2,3-e][1,2,4]thiadiazin-2-yl]-2-methylpropanoic acid.
| Compound Name | 2-[4-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)-1,1,3-trioxothieno[2,3-e][1,2,4]thiadiazin-2-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 87055387 |
| Molecular Formula | C27H30FN3O9S2 |
| Molecular Weight | 623.68 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | 2-[4-[(2R)-2-(5-fluoro-2-methoxyphenyl)-2-(oxan-4-yloxy)ethyl]-7-methyl-6-(1,3-oxazol-2-yl)-1,1,3-trioxothieno[2,3-e][1,2,4]thiadiazin-2-yl]-2-methylpropanoic acid |
| SMILES | COc1ccc(F)cc1[C@H](CN1C(=O)N(C(C)(C)C(=O)O)S(=O)(=O)c2c1sc(-c1ncco1)c2C)OC1CCOCC1 |
| InChI | InChI=1S/C27H30FN3O9S2/c1-15-21(23-29-9-12-39-23)41-24-22(15)42(35,36)31(27(2,3)25(32)33)26(34)30(24)14-20(40-17-7-10-38-11-8-17)18-13-16(28)5-6-19(18)37-4/h5-6,9,12-13,17,20H,7-8,10-11,14H2,1-4H3,(H,32,33)/t20-/m0/s1 |
| InChIKey | PUSVASWLWXNANM-FQEVSTJZSA-N |
| XLogP | 4.59 |
| TPSA | 148.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 623.68 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |