C20H19N3O7S2 — CID 87055540
2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]acetic acid (PubChem CID 87055540) has the molecular formula C20H19N3O7S2 and a molecular weight of 477.52 g/mol. Its IUPAC name is 2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]acetic acid.
| Compound Name | 2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]acetic acid |
|---|---|
| PubChem CID | 87055540 |
| Molecular Formula | C20H19N3O7S2 |
| Molecular Weight | 477.52 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 2-[1-[2-(2-methoxyphenyl)ethyl]-5-methyl-6-(1,3-oxazol-2-yl)-2,2,4-trioxothieno[2,3-c][1,2,6]thiadiazin-3-yl]acetic acid |
| SMILES | COc1ccccc1CCN1c2sc(-c3ncco3)c(C)c2C(=O)N(CC(=O)O)S1(=O)=O |
| InChI | InChI=1S/C20H19N3O7S2/c1-12-16-19(26)23(11-15(24)25)32(27,28)22(9-7-13-5-3-4-6-14(13)29-2)20(16)31-17(12)18-21-8-10-30-18/h3-6,8,10H,7,9,11H2,1-2H3,(H,24,25) |
| InChIKey | NKDGIGXXZCBWLB-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 130.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.52 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |