C27H35N3O3S — CID 87055656
3-[(13S,15R,17E)-17-ethoxyimino-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide (PubChem CID 87055656) has the molecular formula C27H35N3O3S and a molecular weight of 481.66 g/mol. Its IUPAC name is 3-[(13S,15R,17E)-17-ethoxyimino-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide.
| Compound Name | 3-[(13S,15R,17E)-17-ethoxyimino-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 87055656 |
| Molecular Formula | C27H35N3O3S |
| Molecular Weight | 481.66 g/mol |
| Exact Mass | 481.24 |
| IUPAC Name | 3-[(13S,15R,17E)-17-ethoxyimino-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-15-yl]-N-(5-methyl-1,3-thiazol-2-yl)propanamide |
| SMILES | CCO/N=C1\CC(CCC(=O)Nc2ncc(C)s2)C2C3CCc4cc(O)ccc4C3CC[C@]12C |
| InChI | InChI=1S/C27H35N3O3S/c1-4-33-30-23-14-18(6-10-24(32)29-26-28-15-16(2)34-26)25-22-8-5-17-13-19(31)7-9-20(17)21(22)11-12-27(23,25)3/h7,9,13,15,18,21-22,25,31H,4-6,8,10-12,14H2,1-3H3,(H,28,29,32)/b30-23+/t18?,21?,22?,25?,27-/m1/s1 |
| InChIKey | BNUHHNHDAQCXFD-YZCGIDKWSA-N |
| XLogP | 6.05 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.66 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|