C18H22N8O — CID 87055718
2-[4-[5-(ethylamino)pyrimidin-2-yl]piperazin-1-yl]-1H-benzimidazole-4-carboxamide (PubChem CID 87055718) has the molecular formula C18H22N8O and a molecular weight of 366.43 g/mol. Its IUPAC name is 2-[4-[5-(ethylamino)pyrimidin-2-yl]piperazin-1-yl]-1H-benzimidazole-4-carboxamide.
| Compound Name | 2-[4-[5-(ethylamino)pyrimidin-2-yl]piperazin-1-yl]-1H-benzimidazole-4-carboxamide |
|---|---|
| PubChem CID | 87055718 |
| Molecular Formula | C18H22N8O |
| Molecular Weight | 366.43 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | 2-[4-[5-(ethylamino)pyrimidin-2-yl]piperazin-1-yl]-1H-benzimidazole-4-carboxamide |
| SMILES | CCNc1cnc(N2CCN(c3nc4c(C(N)=O)cccc4[nH]3)CC2)nc1 |
| InChI | InChI=1S/C18H22N8O/c1-2-20-12-10-21-17(22-11-12)25-6-8-26(9-7-25)18-23-14-5-3-4-13(16(19)27)15(14)24-18/h3-5,10-11,20H,2,6-9H2,1H3,(H2,19,27)(H,23,24) |
| InChIKey | RXQKALCTXYWXKO-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.43 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |