C44H34N8O4 — CID 87056227
3-anilino-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione (PubChem CID 87056227) has the molecular formula C44H34N8O4 and a molecular weight of 738.81 g/mol. Its IUPAC name is 3-anilino-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione.
| Compound Name | 3-anilino-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
|---|---|
| PubChem CID | 87056227 |
| Molecular Formula | C44H34N8O4 |
| Molecular Weight | 738.81 g/mol |
| Exact Mass | 738.27 |
| IUPAC Name | 3-anilino-4-[1-(3-imidazol-1-ylpropyl)indol-3-yl]pyrrole-2,5-dione;3,4-bis(1H-indol-3-yl)pyrrole-2,5-dione |
| SMILES | O=C1NC(=O)C(c2c[nH]c3ccccc23)=C1c1c[nH]c2ccccc12.O=C1NC(=O)C(c2cn(CCCn3ccnc3)c3ccccc23)=C1Nc1ccccc1 |
| InChI | InChI=1S/C24H21N5O2.C20H13N3O2/c30-23-21(22(24(31)27-23)26-17-7-2-1-3-8-17)19-15-29(20-10-5-4-9-18(19)20)13-6-12-28-14-11-25-16-28;24-19-17(13-9-21-15-7-3-1-5-11(13)15)18(20(25)23-19)14-10-22-16-8-4-2-6-12(14)16/h1-5,7-11,14-16H,6,12-13H2,(H2,26,27,30,31);1-10,21-22H,(H,23,24,25) |
| InChIKey | KFEVGISUUYECES-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 158.70 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 738.81 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|