C26H35F3N4O3S2 — CID 87056366
2-(4-ethylsulfonylphenyl)-N-[(4S)-4-propan-2-yl-5-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-2-yl]acetamide (PubChem CID 87056366) has the molecular formula C26H35F3N4O3S2 and a molecular weight of 572.72 g/mol. Its IUPAC name is 2-(4-ethylsulfonylphenyl)-N-[(4S)-4-propan-2-yl-5-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-2-yl]acetamide.
| Compound Name | 2-(4-ethylsulfonylphenyl)-N-[(4S)-4-propan-2-yl-5-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 87056366 |
| Molecular Formula | C26H35F3N4O3S2 |
| Molecular Weight | 572.72 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | 2-(4-ethylsulfonylphenyl)-N-[(4S)-4-propan-2-yl-5-[[1-(2,2,2-trifluoroethyl)piperidin-4-yl]methyl]-4,6-dihydropyrrolo[3,4-d][1,3]thiazol-2-yl]acetamide |
| SMILES | CCS(=O)(=O)c1ccc(CC(=O)Nc2nc3c(s2)CN(CC2CCN(CC(F)(F)F)CC2)[C@H]3C(C)C)cc1 |
| InChI | InChI=1S/C26H35F3N4O3S2/c1-4-38(35,36)20-7-5-18(6-8-20)13-22(34)30-25-31-23-21(37-25)15-33(24(23)17(2)3)14-19-9-11-32(12-10-19)16-26(27,28)29/h5-8,17,19,24H,4,9-16H2,1-3H3,(H,30,31,34)/t24-/m0/s1 |
| InChIKey | KQMYYYLEYSXREQ-DEOSSOPVSA-N |
| XLogP | 4.90 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.72 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |