C19H14ClF3N6O — CID 87056410
[2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyrimidin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone (PubChem CID 87056410) has the molecular formula C19H14ClF3N6O and a molecular weight of 434.81 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyrimidin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyrimidin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
|---|---|
| PubChem CID | 87056410 |
| Molecular Formula | C19H14ClF3N6O |
| Molecular Weight | 434.81 g/mol |
| Exact Mass | 434.09 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-[(1R,8R)-5-pyrimidin-2-yl-3,4,6,11-tetrazatricyclo[6.2.1.02,6]undeca-2,4-dien-11-yl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1Cl)N1[C@@H]2CC[C@@H]1c1nnc(-c3ncccn3)n1C2 |
| InChI | InChI=1S/C19H14ClF3N6O/c20-14-11(3-1-4-12(14)19(21,22)23)18(30)29-10-5-6-13(29)16-26-27-17(28(16)9-10)15-24-7-2-8-25-15/h1-4,7-8,10,13H,5-6,9H2/t10-,13-/m1/s1 |
| InChIKey | UHVGGRPPRZVREM-ZWNOBZJWSA-N |
| XLogP | 3.77 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.81 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |