C20H16ClF3N6O — CID 87056486
[2-chloro-3-(trifluoromethyl)phenyl]-(5-pyrimidin-2-yl-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl)methanone (PubChem CID 87056486) has the molecular formula C20H16ClF3N6O and a molecular weight of 448.84 g/mol. Its IUPAC name is [2-chloro-3-(trifluoromethyl)phenyl]-(5-pyrimidin-2-yl-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl)methanone.
| Compound Name | [2-chloro-3-(trifluoromethyl)phenyl]-(5-pyrimidin-2-yl-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl)methanone |
|---|---|
| PubChem CID | 87056486 |
| Molecular Formula | C20H16ClF3N6O |
| Molecular Weight | 448.84 g/mol |
| Exact Mass | 448.10 |
| IUPAC Name | [2-chloro-3-(trifluoromethyl)phenyl]-(5-pyrimidin-2-yl-3,4,6,12-tetrazatricyclo[6.3.1.02,6]dodeca-2,4-dien-12-yl)methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1Cl)N1C2CCCC1c1nnc(-c3ncccn3)n1C2 |
| InChI | InChI=1S/C20H16ClF3N6O/c21-15-12(5-2-6-13(15)20(22,23)24)19(31)30-11-4-1-7-14(30)17-27-28-18(29(17)10-11)16-25-8-3-9-26-16/h2-3,5-6,8-9,11,14H,1,4,7,10H2 |
| InChIKey | FCWVNMGJKGGYLS-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 76.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.84 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |