C14H21F2NO4 — CID 87056732
2-O-tert-butyl 3-O-ethyl (1R,3S,4S,5R,6S)-5,6-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate (PubChem CID 87056732) has the molecular formula C14H21F2NO4 and a molecular weight of 305.32 g/mol. Its IUPAC name is 2-O-tert-butyl 3-O-ethyl (1R,3S,4S,5R,6S)-5,6-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate.
| Compound Name | 2-O-tert-butyl 3-O-ethyl (1R,3S,4S,5R,6S)-5,6-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
|---|---|
| PubChem CID | 87056732 |
| Molecular Formula | C14H21F2NO4 |
| Molecular Weight | 305.32 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 2-O-tert-butyl 3-O-ethyl (1R,3S,4S,5R,6S)-5,6-difluoro-2-azabicyclo[2.2.1]heptane-2,3-dicarboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@@H]2C[C@H]([C@H](F)[C@@H]2F)N1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21F2NO4/c1-5-20-12(18)11-7-6-8(10(16)9(7)15)17(11)13(19)21-14(2,3)4/h7-11H,5-6H2,1-4H3/t7-,8-,9-,10+,11+/m1/s1 |
| InChIKey | ABAFCJJMKGKKLR-APLZJWDSSA-N |
| XLogP | 2.23 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |