C23H26N8O2S — CID 87056932
[(7S)-4-[(6-methoxy-1H-pyrazolo[3,4-b]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 87056932) has the molecular formula C23H26N8O2S and a molecular weight of 478.58 g/mol. Its IUPAC name is [(7S)-4-[(6-methoxy-1H-pyrazolo[3,4-b]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [(7S)-4-[(6-methoxy-1H-pyrazolo[3,4-b]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 87056932 |
| Molecular Formula | C23H26N8O2S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.19 |
| IUPAC Name | [(7S)-4-[(6-methoxy-1H-pyrazolo[3,4-b]pyridin-5-yl)amino]-5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-7-yl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | COc1nc2[nH]ncc2cc1Nc1ncnc2sc3c(c12)CC[C@H](C(=O)N1CCN(C)CC1)C3 |
| InChI | InChI=1S/C23H26N8O2S/c1-30-5-7-31(8-6-30)23(32)13-3-4-15-17(10-13)34-22-18(15)20(24-12-25-22)27-16-9-14-11-26-29-19(14)28-21(16)33-2/h9,11-13H,3-8,10H2,1-2H3,(H,24,25,27)(H,26,28,29)/t13-/m0/s1 |
| InChIKey | QLYJQDYDASNSGW-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 112.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |