About 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one
1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one (PubChem CID 87057244) has the molecular formula C20H17N3O2
and a molecular weight of 331.38 g/mol. Its IUPAC name is 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one.
Molecular Properties
| Compound Name | 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one |
| PubChem CID | 87057244 |
| Molecular Formula | C20H17N3O2 |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.13 |
| IUPAC Name | 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one |
| SMILES | Cc1noc(C)c1-c1ccc2ncc(=O)n(Cc3ccccc3)c2c1 |
| InChI | InChI=1S/C20H17N3O2/c1-13-20(14(2)25-22-13)16-8-9-17-18(10-16)23(19(24)11-21-17)12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3 |
| InChIKey | OKJOSAULZOJZTR-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 60.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one?
The IUPAC name of 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one (CID 87057244) is 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one.
What is the SMILES notation for 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one?
The canonical SMILES for 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one is Cc1noc(C)c1-c1ccc2ncc(=O)n(Cc3ccccc3)c2c1.
What is the InChIKey of 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one?
The InChIKey is OKJOSAULZOJZTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H17N3O2/c1-13-20(14(2)25-22-13)16-8-9-17-18(10-16)23(19(24)11-21-17)12-15-6-4-3-5-7-15/h3-11H,12H2,1-2H3.
What are the key properties of 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one?
1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one has a molecular weight of 331.38 g/mol, XLogP of 3.72, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-7-(3,5-dimethyl-1,2-oxazol-4-yl)quinoxalin-2-one is sourced from PubChem (CID 87057244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).