About 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid
6-oxocyclohexa-2,4-diene-1-carboperoxoic acid (PubChem CID 87057796) has the molecular formula C7H6O4
and a molecular weight of 154.12 g/mol. Its IUPAC name is 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid.
Molecular Properties
| Compound Name | 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid |
| PubChem CID | 87057796 |
| Molecular Formula | C7H6O4 |
| Molecular Weight | 154.12 g/mol |
| Exact Mass | 154.03 |
| IUPAC Name | 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid |
| SMILES | O=C1C=CC=CC1C(=O)OO |
| InChI | InChI=1S/C7H6O4/c8-6-4-2-1-3-5(6)7(9)11-10/h1-5,10H |
| InChIKey | MNLZSAWPZQJBHH-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.12 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid?
The IUPAC name of 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid (CID 87057796) is 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid.
What is the SMILES notation for 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid?
The canonical SMILES for 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid is O=C1C=CC=CC1C(=O)OO.
What is the InChIKey of 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid?
The InChIKey is MNLZSAWPZQJBHH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O4/c8-6-4-2-1-3-5(6)7(9)11-10/h1-5,10H.
What are the key properties of 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid?
6-oxocyclohexa-2,4-diene-1-carboperoxoic acid has a molecular weight of 154.12 g/mol, XLogP of 0.31, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-oxocyclohexa-2,4-diene-1-carboperoxoic acid is sourced from PubChem (CID 87057796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).