C26H31F3N6O2 — CID 87057901
3-[4-(3-aminopropylamino)cyclohexyl]-8-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one (PubChem CID 87057901) has the molecular formula C26H31F3N6O2 and a molecular weight of 516.57 g/mol. Its IUPAC name is 3-[4-(3-aminopropylamino)cyclohexyl]-8-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one.
| Compound Name | 3-[4-(3-aminopropylamino)cyclohexyl]-8-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 87057901 |
| Molecular Formula | C26H31F3N6O2 |
| Molecular Weight | 516.57 g/mol |
| Exact Mass | 516.25 |
| IUPAC Name | 3-[4-(3-aminopropylamino)cyclohexyl]-8-[(1E,3Z)-1-amino-5-(trifluoromethyl)hexa-1,3,5-trien-2-yl]-10H-pyrimido[5,4-b][1,4]benzoxazin-2-one |
| SMILES | C=C(/C=C\C(=C/N)c1ccc2c(c1)Nc1nc(=O)n(C3CCC(NCCCN)CC3)cc1O2)C(F)(F)F |
| InChI | InChI=1S/C26H31F3N6O2/c1-16(26(27,28)29)3-4-18(14-31)17-5-10-22-21(13-17)33-24-23(37-22)15-35(25(36)34-24)20-8-6-19(7-9-20)32-12-2-11-30/h3-5,10,13-15,19-20,32H,1-2,6-9,11-12,30-31H2,(H,33,34,36)/b4-3-,18-14+ |
| InChIKey | RFWUBKJHKAPYAZ-XJWLCZITSA-N |
| XLogP | 4.49 |
| TPSA | 120.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.57 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|