C17H24N2O — CID 87058025
(4aR,8aR)-N-benzyl-8a-nitroso-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-amine (PubChem CID 87058025) has the molecular formula C17H24N2O and a molecular weight of 272.39 g/mol. Its IUPAC name is (4aR,8aR)-N-benzyl-8a-nitroso-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-amine.
| Compound Name | (4aR,8aR)-N-benzyl-8a-nitroso-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-amine |
|---|---|
| PubChem CID | 87058025 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | (4aR,8aR)-N-benzyl-8a-nitroso-2,3,4,4a,5,6,7,8-octahydro-1H-naphthalen-1-amine |
| SMILES | O=N[C@]12CCCC[C@@H]1CCCC2NCc1ccccc1 |
| InChI | InChI=1S/C17H24N2O/c20-19-17-12-5-4-9-15(17)10-6-11-16(17)18-13-14-7-2-1-3-8-14/h1-3,7-8,15-16,18H,4-6,9-13H2/t15-,16?,17-/m1/s1 |
| InChIKey | IPCMXERYWXNKPT-PWZMFNOBSA-N |
| XLogP | 4.02 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |