C9H14O2 — CID 87058026
(8aR)-1a,2,4,4a,5,6,7,8-octahydrooxireno[2,3-d]isochromene (PubChem CID 87058026) has the molecular formula C9H14O2 and a molecular weight of 154.21 g/mol. Its IUPAC name is (8aR)-1a,2,4,4a,5,6,7,8-octahydrooxireno[2,3-d]isochromene.
| Compound Name | (8aR)-1a,2,4,4a,5,6,7,8-octahydrooxireno[2,3-d]isochromene |
|---|---|
| PubChem CID | 87058026 |
| Molecular Formula | C9H14O2 |
| Molecular Weight | 154.21 g/mol |
| Exact Mass | 154.10 |
| IUPAC Name | (8aR)-1a,2,4,4a,5,6,7,8-octahydrooxireno[2,3-d]isochromene |
| SMILES | C1CC[C@]23OC2COCC3C1 |
| InChI | InChI=1S/C9H14O2/c1-2-4-9-7(3-1)5-10-6-8(9)11-9/h7-8H,1-6H2/t7?,8?,9-/m1/s1 |
| InChIKey | OUNSOZXNKKNCCG-AMDVSUOASA-N |
| XLogP | 1.34 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.21 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|