About 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione
2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (PubChem CID 87058169) has the molecular formula C11H16N2O2S2
and a molecular weight of 272.39 g/mol. Its IUPAC name is 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
Molecular Properties
| Compound Name | 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| PubChem CID | 87058169 |
| Molecular Formula | C11H16N2O2S2 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.07 |
| IUPAC Name | 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione |
| SMILES | C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1 |
| InChI | InChI=1S/C11H16N2O2S2/c1-9-8-13(7-6-12-9)17(14,15)11-5-3-2-4-10(11)16/h2-3,5,9,12H,4,6-8H2,1H3/t9-/m0/s1 |
| InChIKey | PBQQKAAUVFNOOP-VIFPVBQESA-N |
| XLogP | 0.82 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione?
The IUPAC name of 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione (CID 87058169) is 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione.
What is the SMILES notation for 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione?
The canonical SMILES for 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione is C[C@H]1CN(S(=O)(=O)C2=CC=CCC2=S)CCN1.
What is the InChIKey of 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione?
The InChIKey is PBQQKAAUVFNOOP-VIFPVBQESA-N. The full InChI is InChI=1S/C11H16N2O2S2/c1-9-8-13(7-6-12-9)17(14,15)11-5-3-2-4-10(11)16/h2-3,5,9,12H,4,6-8H2,1H3/t9-/m0/s1.
What are the key properties of 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione?
2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione has a molecular weight of 272.39 g/mol, XLogP of 0.82, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S)-3-methylpiperazin-1-yl]sulfonylcyclohexa-2,4-diene-1-thione is sourced from PubChem (CID 87058169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).