C18H19F6N5O3S — CID 87058233
2-[2-[4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87058233) has the molecular formula C18H19F6N5O3S and a molecular weight of 499.44 g/mol. Its IUPAC name is 2-[2-[4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-[4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87058233 |
| Molecular Formula | C18H19F6N5O3S |
| Molecular Weight | 499.44 g/mol |
| Exact Mass | 499.11 |
| IUPAC Name | 2-[2-[4-(2-aminophenyl)sulfonyl-2-methylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC1CN(S(=O)(=O)c2ccccc2N)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C18H19F6N5O3S/c1-11-10-28(33(31,32)14-5-3-2-4-13(14)25)6-7-29(11)15-26-8-12(9-27-15)16(30,17(19,20)21)18(22,23)24/h2-5,8-9,11,30H,6-7,10,25H2,1H3 |
| InChIKey | UKDIEAMXFIACNE-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 112.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.44 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|