C23H26ClF6N7O4S — CID 87058270
4-[[(2S)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one (PubChem CID 87058270) has the molecular formula C23H26ClF6N7O4S and a molecular weight of 646.01 g/mol. Its IUPAC name is 4-[[(2S)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[[(2S)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 87058270 |
| Molecular Formula | C23H26ClF6N7O4S |
| Molecular Weight | 646.01 g/mol |
| Exact Mass | 645.14 |
| IUPAC Name | 4-[[(2S)-4-[(6-chloro-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C[C@@]1(c2ncc(C(O)(C(F)(F)F)C(F)(F)F)cn2)CN(S(=O)(=O)c2ccc(Cl)nc2)CCN1 |
| InChI | InChI=1S/C23H26ClF6N7O4S/c1-19(2)18(38)31-5-7-36(19)12-20(13-37(8-6-35-20)42(40,41)15-3-4-16(24)32-11-15)17-33-9-14(10-34-17)21(39,22(25,26)27)23(28,29)30/h3-4,9-11,35,39H,5-8,12-13H2,1-2H3,(H,31,38)/t20-/m0/s1 |
| InChIKey | NEJMYHYXVBIVKH-FQEVSTJZSA-N |
| XLogP | 1.54 |
| TPSA | 140.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.01 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|