C17H22F6N4O2 — CID 87058338
1,1,1,3,3,3-hexafluoro-2-[2-[(2S)-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]propan-2-ol (PubChem CID 87058338) has the molecular formula C17H22F6N4O2 and a molecular weight of 428.38 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[2-[(2S)-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]propan-2-ol.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[2-[(2S)-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]propan-2-ol |
|---|---|
| PubChem CID | 87058338 |
| Molecular Formula | C17H22F6N4O2 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[2-[(2S)-2-(oxan-4-ylmethyl)piperazin-1-yl]pyrimidin-5-yl]propan-2-ol |
| SMILES | OC(c1cnc(N2CCNC[C@@H]2CC2CCOCC2)nc1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C17H22F6N4O2/c18-16(19,20)15(28,17(21,22)23)12-8-25-14(26-9-12)27-4-3-24-10-13(27)7-11-1-5-29-6-2-11/h8-9,11,13,24,28H,1-7,10H2/t13-/m0/s1 |
| InChIKey | DQWOLZQKKKFABI-ZDUSSCGKSA-N |
| XLogP | 2.38 |
| TPSA | 70.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |