C23H28F6N8O4S — CID 87058482
4-[[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one (PubChem CID 87058482) has the molecular formula C23H28F6N8O4S and a molecular weight of 626.58 g/mol. Its IUPAC name is 4-[[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 87058482 |
| Molecular Formula | C23H28F6N8O4S |
| Molecular Weight | 626.58 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 4-[[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-[5-(1,1,1,3,3,3-hexafluoro-2-hydroxypropan-2-yl)pyrimidin-2-yl]piperazin-2-yl]methyl]-3,3-dimethylpiperazin-2-one |
| SMILES | CC1(C)C(=O)NCCN1C[C@@]1(c2ncc(C(O)(C(F)(F)F)C(F)(F)F)cn2)CN(S(=O)(=O)c2ccc(N)nc2)CCN1 |
| InChI | InChI=1S/C23H28F6N8O4S/c1-19(2)18(38)31-5-7-36(19)12-20(13-37(8-6-35-20)42(40,41)15-3-4-16(30)32-11-15)17-33-9-14(10-34-17)21(39,22(24,25)26)23(27,28)29/h3-4,9-11,35,39H,5-8,12-13H2,1-2H3,(H2,30,32)(H,31,38)/t20-/m0/s1 |
| InChIKey | CHKQAFGRIODCGI-FQEVSTJZSA-N |
| XLogP | 0.47 |
| TPSA | 166.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.58 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |