C19H18F6N6O3S — CID 87058555
2-[2-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 87058555) has the molecular formula C19H18F6N6O3S and a molecular weight of 524.45 g/mol. Its IUPAC name is 2-[2-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[2-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 87058555 |
| Molecular Formula | C19H18F6N6O3S |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 524.11 |
| IUPAC Name | 2-[2-[(2S)-4-[(6-amino-3-pyridinyl)sulfonyl]-2-prop-1-ynylpiperazin-1-yl]pyrimidin-5-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | CC#C[C@H]1CN(S(=O)(=O)c2ccc(N)nc2)CCN1c1ncc(C(O)(C(F)(F)F)C(F)(F)F)cn1 |
| InChI | InChI=1S/C19H18F6N6O3S/c1-2-3-13-11-30(35(33,34)14-4-5-15(26)27-10-14)6-7-31(13)16-28-8-12(9-29-16)17(32,18(20,21)22)19(23,24)25/h4-5,8-10,13,32H,6-7,11H2,1H3,(H2,26,27)/t13-/m0/s1 |
| InChIKey | CWDXIMHMPWZRFK-ZDUSSCGKSA-N |
| XLogP | 1.67 |
| TPSA | 125.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|