About CID 87058831
CID 87058831 (PubChem CID 87058831) has the molecular formula C40H61BN6O7Si2
and a molecular weight of 804.95 g/mol.
Molecular Properties
| Compound Name | CID 87058831 |
| PubChem CID | 87058831 |
| Molecular Formula | C40H61BN6O7Si2 |
| Molecular Weight | 804.95 g/mol |
| Exact Mass | 804.42 |
| IUPAC Name | — |
| SMILES | [B]c1c(C2CCC(OCCOC)(C(=O)OCCOC)CC2)nc2c(-c3cnn(-c4ccccc4)c3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C |
| InChI | InChI=1S/C40H61BN6O7Si2/c1-49-18-20-53-39(48)40(54-21-19-50-2)16-14-31(15-17-40)36-35(41)38(45(29-51-22-24-55(3,4)5)30-52-23-25-56(6,7)8)47-37(44-36)34(27-43-47)32-26-42-46(28-32)33-12-10-9-11-13-33/h9-13,26-28,31H,14-25,29-30H2,1-8H3 |
| InChIKey | VTGQEVQJNPGQLJ-UHFFFAOYSA-N |
| XLogP | 6.06 |
| TPSA | 123.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 56 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 804.95 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze CID 87058831 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 87058831?
The IUPAC name of CID 87058831 (CID 87058831) is not available.
What is the SMILES notation for CID 87058831?
The canonical SMILES for CID 87058831 is [B]c1c(C2CCC(OCCOC)(C(=O)OCCOC)CC2)nc2c(-c3cnn(-c4ccccc4)c3)cnn2c1N(COCC[Si](C)(C)C)COCC[Si](C)(C)C.
What is the InChIKey of CID 87058831?
The InChIKey is VTGQEVQJNPGQLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C40H61BN6O7Si2/c1-49-18-20-53-39(48)40(54-21-19-50-2)16-14-31(15-17-40)36-35(41)38(45(29-51-22-24-55(3,4)5)30-52-23-25-56(6,7)8)47-37(44-36)34(27-43-47)32-26-42-46(28-32)33-12-10-9-11-13-33/h9-13,26-28,31H,14-25,29-30H2,1-8H3.
What are the key properties of CID 87058831?
CID 87058831 has a molecular weight of 804.95 g/mol, XLogP of 6.06, 22 rotatable bonds, 0 hydrogen bond donors, and 13 hydrogen bond acceptors.
Where does this data come from?
All data for CID 87058831 is sourced from PubChem (CID 87058831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).