About 6-methoxydeca-1,9-dien-5-one
6-methoxydeca-1,9-dien-5-one (PubChem CID 87059269) has the molecular formula C11H18O2
and a molecular weight of 182.26 g/mol. Its IUPAC name is 6-methoxydeca-1,9-dien-5-one.
Molecular Properties
| Compound Name | 6-methoxydeca-1,9-dien-5-one |
| PubChem CID | 87059269 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 6-methoxydeca-1,9-dien-5-one |
| SMILES | C=CCCC(=O)C(CCC=C)OC |
| InChI | InChI=1S/C11H18O2/c1-4-6-8-10(12)11(13-3)9-7-5-2/h4-5,11H,1-2,6-9H2,3H3 |
| InChIKey | VUWRBADEZKQRHY-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxydeca-1,9-dien-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxydeca-1,9-dien-5-one?
The IUPAC name of 6-methoxydeca-1,9-dien-5-one (CID 87059269) is 6-methoxydeca-1,9-dien-5-one.
What is the SMILES notation for 6-methoxydeca-1,9-dien-5-one?
The canonical SMILES for 6-methoxydeca-1,9-dien-5-one is C=CCCC(=O)C(CCC=C)OC.
What is the InChIKey of 6-methoxydeca-1,9-dien-5-one?
The InChIKey is VUWRBADEZKQRHY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2/c1-4-6-8-10(12)11(13-3)9-7-5-2/h4-5,11H,1-2,6-9H2,3H3.
What are the key properties of 6-methoxydeca-1,9-dien-5-one?
6-methoxydeca-1,9-dien-5-one has a molecular weight of 182.26 g/mol, XLogP of 2.50, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxydeca-1,9-dien-5-one is sourced from PubChem (CID 87059269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).