C41H73NO2 — CID 87059499
(6Z,9Z,29Z,32Z)-19-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraene-18,21-dione (PubChem CID 87059499) has the molecular formula C41H73NO2 and a molecular weight of 612.04 g/mol. Its IUPAC name is (6Z,9Z,29Z,32Z)-19-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraene-18,21-dione.
| Compound Name | (6Z,9Z,29Z,32Z)-19-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraene-18,21-dione |
|---|---|
| PubChem CID | 87059499 |
| Molecular Formula | C41H73NO2 |
| Molecular Weight | 612.04 g/mol |
| Exact Mass | 611.56 |
| IUPAC Name | (6Z,9Z,29Z,32Z)-19-[(dimethylamino)methyl]octatriaconta-6,9,29,32-tetraene-18,21-dione |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC(=O)CC(CN(C)C)C(=O)CCCCCCC/C=C\C/C=C\CCCCC |
| InChI | InChI=1S/C41H73NO2/c1-5-7-9-11-13-15-17-19-21-23-25-27-29-31-33-35-40(43)37-39(38-42(3)4)41(44)36-34-32-30-28-26-24-22-20-18-16-14-12-10-8-6-2/h13-16,19-22,39H,5-12,17-18,23-38H2,1-4H3/b15-13-,16-14-,21-19-,22-20- |
| InChIKey | VDYVTMXBGOIUMS-KWXKLSQISA-N |
| XLogP | 12.32 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 33 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 612.04 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|