About (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one
(7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one (PubChem CID 87059584) has the molecular formula C15H13BrO
and a molecular weight of 289.17 g/mol. Its IUPAC name is (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one.
Molecular Properties
| Compound Name | (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one |
| PubChem CID | 87059584 |
| Molecular Formula | C15H13BrO |
| Molecular Weight | 289.17 g/mol |
| Exact Mass | 288.01 |
| IUPAC Name | (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one |
| SMILES | O=C1CC=CCC[C@]12C=c1ccc(Br)cc1=C2 |
| InChI | InChI=1S/C15H13BrO/c16-13-6-5-11-9-15(10-12(11)8-13)7-3-1-2-4-14(15)17/h1-2,5-6,8-10H,3-4,7H2/t15-/m1/s1 |
| InChIKey | IPCTUAOKAYDGHE-OAHLLOKOSA-N |
| XLogP | 2.32 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one?
The IUPAC name of (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one (CID 87059584) is (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one.
What is the SMILES notation for (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one?
The canonical SMILES for (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one is O=C1CC=CCC[C@]12C=c1ccc(Br)cc1=C2.
What is the InChIKey of (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one?
The InChIKey is IPCTUAOKAYDGHE-OAHLLOKOSA-N. The full InChI is InChI=1S/C15H13BrO/c16-13-6-5-11-9-15(10-12(11)8-13)7-3-1-2-4-14(15)17/h1-2,5-6,8-10H,3-4,7H2/t15-/m1/s1.
What are the key properties of (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one?
(7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one has a molecular weight of 289.17 g/mol, XLogP of 2.32, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7R)-5'-bromospiro[cyclohept-3-ene-7,2'-indene]-1-one is sourced from PubChem (CID 87059584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).