C10H13ClO3 — CID 87059730
methyl (2R,3Z,5Z)-4-chloro-3-ethenyl-2-hydroxyhepta-3,5-dienoate (PubChem CID 87059730) has the molecular formula C10H13ClO3 and a molecular weight of 216.66 g/mol. Its IUPAC name is methyl (2R,3Z,5Z)-4-chloro-3-ethenyl-2-hydroxyhepta-3,5-dienoate.
| Compound Name | methyl (2R,3Z,5Z)-4-chloro-3-ethenyl-2-hydroxyhepta-3,5-dienoate |
|---|---|
| PubChem CID | 87059730 |
| Molecular Formula | C10H13ClO3 |
| Molecular Weight | 216.66 g/mol |
| Exact Mass | 216.06 |
| IUPAC Name | methyl (2R,3Z,5Z)-4-chloro-3-ethenyl-2-hydroxyhepta-3,5-dienoate |
| SMILES | C=C/C(=C(Cl)\C=C/C)[C@@H](O)C(=O)OC |
| InChI | InChI=1S/C10H13ClO3/c1-4-6-8(11)7(5-2)9(12)10(13)14-3/h4-6,9,12H,2H2,1,3H3/b6-4-,8-7-/t9-/m1/s1 |
| InChIKey | BJENOZDXZQROJW-KBVHLVLMSA-N |
| XLogP | 1.78 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.66 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|