About 2-ethoxy-2-ethyloxirane
2-ethoxy-2-ethyloxirane (PubChem CID 87059736) has the molecular formula C6H12O2
and a molecular weight of 116.16 g/mol. Its IUPAC name is 2-ethoxy-2-ethyloxirane.
Molecular Properties
| Compound Name | 2-ethoxy-2-ethyloxirane |
| PubChem CID | 87059736 |
| Molecular Formula | C6H12O2 |
| Molecular Weight | 116.16 g/mol |
| Exact Mass | 116.08 |
| IUPAC Name | 2-ethoxy-2-ethyloxirane |
| SMILES | CCOC1(CC)CO1 |
| InChI | InChI=1S/C6H12O2/c1-3-6(5-8-6)7-4-2/h3-5H2,1-2H3 |
| InChIKey | FZKSOQQMBCLXII-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 116.16 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxy-2-ethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxy-2-ethyloxirane?
The IUPAC name of 2-ethoxy-2-ethyloxirane (CID 87059736) is 2-ethoxy-2-ethyloxirane.
What is the SMILES notation for 2-ethoxy-2-ethyloxirane?
The canonical SMILES for 2-ethoxy-2-ethyloxirane is CCOC1(CC)CO1.
What is the InChIKey of 2-ethoxy-2-ethyloxirane?
The InChIKey is FZKSOQQMBCLXII-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O2/c1-3-6(5-8-6)7-4-2/h3-5H2,1-2H3.
What are the key properties of 2-ethoxy-2-ethyloxirane?
2-ethoxy-2-ethyloxirane has a molecular weight of 116.16 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxy-2-ethyloxirane is sourced from PubChem (CID 87059736), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).